C19H32 — CID 144843023
(3Z,8Z)-2,10-dimethyl-5,7-dimethylideneundeca-1,3,8,10-tetraene;ethane (PubChem CID 144843023) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is (3Z,8Z)-2,10-dimethyl-5,7-dimethylideneundeca-1,3,8,10-tetraene;ethane.
| Compound Name | (3Z,8Z)-2,10-dimethyl-5,7-dimethylideneundeca-1,3,8,10-tetraene;ethane |
|---|---|
| PubChem CID | 144843023 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | (3Z,8Z)-2,10-dimethyl-5,7-dimethylideneundeca-1,3,8,10-tetraene;ethane |
| SMILES | C=C(C)/C=C\C(=C)CC(=C)/C=C\C(=C)C.CC.CC |
| InChI | InChI=1S/C15H20.2C2H6/c1-12(2)7-9-14(5)11-15(6)10-8-13(3)4;2*1-2/h7-10H,1,3,5-6,11H2,2,4H3;2*1-2H3/b9-7-,10-8-;; |
| InChIKey | GFPZEATTWXSOMO-RXRQIEPESA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|