C10H17N — CID 142124132
(3Z)-N,N,5-trimethyl-2-methylidenehexa-3,5-dien-1-amine (PubChem CID 142124132) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (3Z)-N,N,5-trimethyl-2-methylidenehexa-3,5-dien-1-amine.
| Compound Name | (3Z)-N,N,5-trimethyl-2-methylidenehexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142124132 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (3Z)-N,N,5-trimethyl-2-methylidenehexa-3,5-dien-1-amine |
| SMILES | C=C(C)/C=C\C(=C)CN(C)C |
| InChI | InChI=1S/C10H17N/c1-9(2)6-7-10(3)8-11(4)5/h6-7H,1,3,8H2,2,4-5H3/b7-6- |
| InChIKey | NYSXNAZSATWOFU-SREVYHEPSA-N |
| XLogP | 2.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|