C7H10OU — CID 143030811
(3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium (PubChem CID 143030811) has the molecular formula C7H10OU and a molecular weight of 348.19 g/mol. Its IUPAC name is (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium.
| Compound Name | (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium |
|---|---|
| PubChem CID | 143030811 |
| Molecular Formula | C7H10OU |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium |
| SMILES | C=C(C)/C=C\C(=C)O.[U] |
| InChI | InChI=1S/C7H10O.U/c1-6(2)4-5-7(3)8;/h4-5,8H,1,3H2,2H3;/b5-4-; |
| InChIKey | FYGZSFOONWQVHQ-MKWAYWHRSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|