About (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium
(3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium (PubChem CID 143030811) has the molecular formula C7H10OU
and a molecular weight of 348.19 g/mol. Its IUPAC name is (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium.
Molecular Properties
| Compound Name | (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium |
| PubChem CID | 143030811 |
| Molecular Formula | C7H10OU |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium |
| SMILES | C=C(C)/C=C\C(=C)O.[U] |
| InChI | InChI=1S/C7H10O.U/c1-6(2)4-5-7(3)8;/h4-5,8H,1,3H2,2H3;/b5-4-; |
| InChIKey | FYGZSFOONWQVHQ-MKWAYWHRSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium?
The IUPAC name of (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium (CID 143030811) is (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium.
What is the SMILES notation for (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium?
The canonical SMILES for (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium is C=C(C)/C=C\C(=C)O.[U].
What is the InChIKey of (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium?
The InChIKey is FYGZSFOONWQVHQ-MKWAYWHRSA-N. The full InChI is InChI=1S/C7H10O.U/c1-6(2)4-5-7(3)8;/h4-5,8H,1,3H2,2H3;/b5-4-;.
What are the key properties of (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium?
(3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium has a molecular weight of 348.19 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-methylhexa-1,3,5-trien-2-ol;uranium is sourced from PubChem (CID 143030811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).