C7H10OS — CID 143019199
(3Z)-5-methylsulfanylhexa-1,3,5-trien-2-ol (PubChem CID 143019199) has the molecular formula C7H10OS and a molecular weight of 142.22 g/mol. Its IUPAC name is (3Z)-5-methylsulfanylhexa-1,3,5-trien-2-ol.
| Compound Name | (3Z)-5-methylsulfanylhexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 143019199 |
| Molecular Formula | C7H10OS |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | (3Z)-5-methylsulfanylhexa-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)SC |
| InChI | InChI=1S/C7H10OS/c1-6(8)4-5-7(2)9-3/h4-5,8H,1-2H2,3H3/b5-4- |
| InChIKey | FCIZAAKZWXWCJG-PLNGDYQASA-N |
| XLogP | 2.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|