C6H11NS — CID 148853023
(1Z)-N-methyl-3-methylsulfanylbuta-1,3-dien-1-amine (PubChem CID 148853023) has the molecular formula C6H11NS and a molecular weight of 129.23 g/mol. Its IUPAC name is (1Z)-N-methyl-3-methylsulfanylbuta-1,3-dien-1-amine.
| Compound Name | (1Z)-N-methyl-3-methylsulfanylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 148853023 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | (1Z)-N-methyl-3-methylsulfanylbuta-1,3-dien-1-amine |
| SMILES | C=C(/C=C\NC)SC |
| InChI | InChI=1S/C6H11NS/c1-6(8-3)4-5-7-2/h4-5,7H,1H2,2-3H3/b5-4- |
| InChIKey | OXVDNHBJFCFUFS-PLNGDYQASA-N |
| XLogP | 1.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|