C10H17NS — CID 163392986
(1Z,3E)-N-methyl-3-methylsulfanyl-2-prop-1-en-2-ylpenta-1,3-dien-1-amine (PubChem CID 163392986) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is (1Z,3E)-N-methyl-3-methylsulfanyl-2-prop-1-en-2-ylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N-methyl-3-methylsulfanyl-2-prop-1-en-2-ylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163392986 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (1Z,3E)-N-methyl-3-methylsulfanyl-2-prop-1-en-2-ylpenta-1,3-dien-1-amine |
| SMILES | C=C(C)C(=C/NC)/C(=C\C)SC |
| InChI | InChI=1S/C10H17NS/c1-6-10(12-5)9(7-11-4)8(2)3/h6-7,11H,2H2,1,3-5H3/b9-7-,10-6+ |
| InChIKey | INFVQGNPPADYKF-ODUODFHUSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|