C7H12S — CID 88850042
(3Z)-3-methyl-2-methylsulfanylpenta-1,3-diene (PubChem CID 88850042) has the molecular formula C7H12S and a molecular weight of 128.24 g/mol. Its IUPAC name is (3Z)-3-methyl-2-methylsulfanylpenta-1,3-diene.
| Compound Name | (3Z)-3-methyl-2-methylsulfanylpenta-1,3-diene |
|---|---|
| PubChem CID | 88850042 |
| Molecular Formula | C7H12S |
| Molecular Weight | 128.24 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (3Z)-3-methyl-2-methylsulfanylpenta-1,3-diene |
| SMILES | C=C(SC)/C(C)=C\C |
| InChI | InChI=1S/C7H12S/c1-5-6(2)7(3)8-4/h5H,3H2,1-2,4H3/b6-5- |
| InChIKey | JTHYZJGBBNYVRZ-WAYWQWQTSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|