C8H9F3O — CID 102121795
(4E)-4-methyl-2-(trifluoromethyl)hexa-1,4-dien-3-one (PubChem CID 102121795) has the molecular formula C8H9F3O and a molecular weight of 178.15 g/mol. Its IUPAC name is (4E)-4-methyl-2-(trifluoromethyl)hexa-1,4-dien-3-one.
| Compound Name | (4E)-4-methyl-2-(trifluoromethyl)hexa-1,4-dien-3-one |
|---|---|
| PubChem CID | 102121795 |
| Molecular Formula | C8H9F3O |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (4E)-4-methyl-2-(trifluoromethyl)hexa-1,4-dien-3-one |
| SMILES | C=C(C(=O)/C(C)=C/C)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O/c1-4-5(2)7(12)6(3)8(9,10)11/h4H,3H2,1-2H3/b5-4+ |
| InChIKey | LTRWQTNVXYYPEZ-SNAWJCMRSA-N |
| XLogP | 2.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|