C9H13F3O — CID 134267480
4,4-dimethyl-2-(trifluoromethyl)hex-1-en-3-one (PubChem CID 134267480) has the molecular formula C9H13F3O and a molecular weight of 194.20 g/mol. Its IUPAC name is 4,4-dimethyl-2-(trifluoromethyl)hex-1-en-3-one.
| Compound Name | 4,4-dimethyl-2-(trifluoromethyl)hex-1-en-3-one |
|---|---|
| PubChem CID | 134267480 |
| Molecular Formula | C9H13F3O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4,4-dimethyl-2-(trifluoromethyl)hex-1-en-3-one |
| SMILES | C=C(C(=O)C(C)(C)CC)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O/c1-5-8(3,4)7(13)6(2)9(10,11)12/h2,5H2,1,3-4H3 |
| InChIKey | FNEIAPAKWIYPLG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|