C11H18F2O4 — CID 89254622
2-(1,1-difluoro-2-hydroxyprop-2-enoxy)ethyl 2,2-dimethylbutanoate (PubChem CID 89254622) has the molecular formula C11H18F2O4 and a molecular weight of 252.26 g/mol. Its IUPAC name is 2-(1,1-difluoro-2-hydroxyprop-2-enoxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(1,1-difluoro-2-hydroxyprop-2-enoxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 89254622 |
| Molecular Formula | C11H18F2O4 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-(1,1-difluoro-2-hydroxyprop-2-enoxy)ethyl 2,2-dimethylbutanoate |
| SMILES | C=C(O)C(F)(F)OCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C11H18F2O4/c1-5-10(3,4)9(15)16-6-7-17-11(12,13)8(2)14/h14H,2,5-7H2,1,3-4H3 |
| InChIKey | PNJSWHFHWFXHDM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|