C6H7F3O4 — CID 157277340
2-methylprop-2-enoic acid;2,2,2-trifluoroacetic acid (PubChem CID 157277340) has the molecular formula C6H7F3O4 and a molecular weight of 200.11 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methylprop-2-enoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 157277340 |
| Molecular Formula | C6H7F3O4 |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 2-methylprop-2-enoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C=C(C)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C4H6O2.C2HF3O2/c1-3(2)4(5)6;3-2(4,5)1(6)7/h1H2,2H3,(H,5,6);(H,6,7) |
| InChIKey | AZGKTGJUHFEJHQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|