C10H10F12O4 — CID 159325388
bis(1,1,1,3,3,3-hexafluoropropan-2-ol);2-methylprop-2-enoic acid (PubChem CID 159325388) has the molecular formula C10H10F12O4 and a molecular weight of 422.16 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-ol);2-methylprop-2-enoic acid.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-ol);2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 159325388 |
| Molecular Formula | C10H10F12O4 |
| Molecular Weight | 422.16 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-ol);2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.OC(C(F)(F)F)C(F)(F)F.OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H6O2.2C3H2F6O/c1-3(2)4(5)6;2*4-2(5,6)1(10)3(7,8)9/h1H2,2H3,(H,5,6);2*1,10H |
| InChIKey | LEHHVQSLZJSBEX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.16 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|