C13H18F6O6 — CID 87363982
1,1,2,3,4,5-hexafluoropentane-1,5-diol;bis(2-methylprop-2-enoic acid) (PubChem CID 87363982) has the molecular formula C13H18F6O6 and a molecular weight of 384.27 g/mol. Its IUPAC name is 1,1,2,3,4,5-hexafluoropentane-1,5-diol;bis(2-methylprop-2-enoic acid).
| Compound Name | 1,1,2,3,4,5-hexafluoropentane-1,5-diol;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 87363982 |
| Molecular Formula | C13H18F6O6 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1,1,2,3,4,5-hexafluoropentane-1,5-diol;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.OC(F)C(F)C(F)C(F)C(O)(F)F |
| InChI | InChI=1S/C5H6F6O2.2C4H6O2/c6-1(2(7)4(9)12)3(8)5(10,11)13;2*1-3(2)4(5)6/h1-4,12-13H;2*1H2,2H3,(H,5,6) |
| InChIKey | JWRSPZFVUPGTGY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|