C11H10F12O3 — CID 174617566
1,1,2,2,3,3,4,4,5,6,7,7-dodecafluoroheptan-1-ol;2-methylprop-2-enoic acid (PubChem CID 174617566) has the molecular formula C11H10F12O3 and a molecular weight of 418.17 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,6,7,7-dodecafluoroheptan-1-ol;2-methylprop-2-enoic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,6,7,7-dodecafluoroheptan-1-ol;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174617566 |
| Molecular Formula | C11H10F12O3 |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,6,7,7-dodecafluoroheptan-1-ol;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C7H4F12O.C4H6O2/c8-1(3(10)11)2(9)4(12,13)5(14,15)6(16,17)7(18,19)20;1-3(2)4(5)6/h1-3,20H;1H2,2H3,(H,5,6) |
| InChIKey | PHOQGZKIGVODGQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|