C13H8F18O4 — CID 87359737
2-methylprop-2-enoic acid;1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-octadecafluorononane-1,2-diol (PubChem CID 87359737) has the molecular formula C13H8F18O4 and a molecular weight of 570.17 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-octadecafluorononane-1,2-diol.
| Compound Name | 2-methylprop-2-enoic acid;1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-octadecafluorononane-1,2-diol |
|---|---|
| PubChem CID | 87359737 |
| Molecular Formula | C13H8F18O4 |
| Molecular Weight | 570.17 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | 2-methylprop-2-enoic acid;1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-octadecafluorononane-1,2-diol |
| SMILES | C=C(C)C(=O)O.OC(F)(F)C(O)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H2F18O2.C4H6O2/c10-1(11,2(12,13)4(16,17)6(20,21)8(23,24)25)3(14,15)5(18,19)7(22,28)9(26,27)29;1-3(2)4(5)6/h28-29H;1H2,2H3,(H,5,6) |
| InChIKey | AMOJUQZOPFOGQA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.17 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|