C13H7F17O4 — CID 87139873
1,1,1,2,2,3,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-3-hydroxynonan-4-one;2-methylprop-2-enoic acid (PubChem CID 87139873) has the molecular formula C13H7F17O4 and a molecular weight of 550.16 g/mol. Its IUPAC name is 1,1,1,2,2,3,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-3-hydroxynonan-4-one;2-methylprop-2-enoic acid.
| Compound Name | 1,1,1,2,2,3,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-3-hydroxynonan-4-one;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 87139873 |
| Molecular Formula | C13H7F17O4 |
| Molecular Weight | 550.16 g/mol |
| Exact Mass | 550.01 |
| IUPAC Name | 1,1,1,2,2,3,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-3-hydroxynonan-4-one;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.O=C(C(O)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9HF17O2.C4H6O2/c10-2(11,1(27)3(12,28)5(15,16)8(21,22)23)4(13,14)6(17,18)7(19,20)9(24,25)26;1-3(2)4(5)6/h28H;1H2,2H3,(H,5,6) |
| InChIKey | QQPZZZQBURAMSE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.16 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|