C8HBaF15O2 — CID 87197616
CID 87197616 (PubChem CID 87197616) has the molecular formula C8HBaF15O2 and a molecular weight of 551.39 g/mol.
| Compound Name | CID 87197616 |
|---|---|
| PubChem CID | 87197616 |
| Molecular Formula | C8HBaF15O2 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 551.88 |
| IUPAC Name | — |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Ba] |
| InChI | InChI=1S/C8HF15O2.Ba/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23;/h(H,24,25); |
| InChIKey | MNXZXXGULXYPIB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|