C7HAgF13O2 — CID 142472251
silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid (PubChem CID 142472251) has the molecular formula C7HAgF13O2 and a molecular weight of 471.93 g/mol. Its IUPAC name is silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid.
| Compound Name | silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid |
|---|---|
| PubChem CID | 142472251 |
| Molecular Formula | C7HAgF13O2 |
| Molecular Weight | 471.93 g/mol |
| Exact Mass | 470.88 |
| IUPAC Name | silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Ag] |
| InChI | InChI=1S/C7HF13O2.Ag/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20;/h(H,21,22); |
| InChIKey | AOVPMQCCFZPBJA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.93 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|