silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid

C7HAgF13O2 — CID 142472251

IUPACsilver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid
SMILESO=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Ag]
InChIInChI=1S/C7HF13O2.Ag/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20;/h(H,21,22);
InChIKeyAOVPMQCCFZPBJA-UHFFFAOYSA-N
MW471.93 g/mol
LogP3.81
Rot. Bonds5

About silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid

silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid (PubChem CID 142472251) has the molecular formula C7HAgF13O2 and a molecular weight of 471.93 g/mol. Its IUPAC name is silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid.

Molecular Properties

Compound Namesilver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid
PubChem CID142472251
Molecular FormulaC7HAgF13O2
Molecular Weight471.93 g/mol
Exact Mass470.88
IUPAC Namesilver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid
SMILESO=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Ag]
InChIInChI=1S/C7HF13O2.Ag/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20;/h(H,21,22);
InChIKeyAOVPMQCCFZPBJA-UHFFFAOYSA-N
XLogP3.81
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500471.93
LogP ≤ 53.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid?
The IUPAC name of silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid (CID 142472251) is silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid.
What is the SMILES notation for silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid?
The canonical SMILES for silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid is O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Ag].
What is the InChIKey of silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid?
The InChIKey is AOVPMQCCFZPBJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7HF13O2.Ag/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20;/h(H,21,22);.
What are the key properties of silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid?
silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid has a molecular weight of 471.93 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for silver;2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid is sourced from PubChem (CID 142472251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).