C6H5F9O3 — CID 175541225
methanol;2,2,3,3,4,4,5,5,5-nonafluoropentanoic acid (PubChem CID 175541225) has the molecular formula C6H5F9O3 and a molecular weight of 296.09 g/mol. Its IUPAC name is methanol;2,2,3,3,4,4,5,5,5-nonafluoropentanoic acid.
| Compound Name | methanol;2,2,3,3,4,4,5,5,5-nonafluoropentanoic acid |
|---|---|
| PubChem CID | 175541225 |
| Molecular Formula | C6H5F9O3 |
| Molecular Weight | 296.09 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | methanol;2,2,3,3,4,4,5,5,5-nonafluoropentanoic acid |
| SMILES | CO.O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5HF9O2.CH4O/c6-2(7,1(15)16)3(8,9)4(10,11)5(12,13)14;1-2/h(H,15,16);2H,1H3 |
| InChIKey | RQDWEJVNEZRYOF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.09 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|