C12H12F15NO2 — CID 13311593
2-methylpropan-2-amine;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid (PubChem CID 13311593) has the molecular formula C12H12F15NO2 and a molecular weight of 487.20 g/mol. Its IUPAC name is 2-methylpropan-2-amine;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid.
| Compound Name | 2-methylpropan-2-amine;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid |
|---|---|
| PubChem CID | 13311593 |
| Molecular Formula | C12H12F15NO2 |
| Molecular Weight | 487.20 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 2-methylpropan-2-amine;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid |
| SMILES | CC(C)(C)N.O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8HF15O2.C4H11N/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23;1-4(2,3)5/h(H,24,25);5H2,1-3H3 |
| InChIKey | KFHJXSXNGRVURR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.20 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|