C7H2F10O4 — CID 4118201
2,2,3,3,4,4,5,5,6,6-decafluoroheptanedioic acid (PubChem CID 4118201) has the molecular formula C7H2F10O4 and a molecular weight of 340.07 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoroheptanedioic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoroheptanedioic acid |
|---|---|
| PubChem CID | 4118201 |
| Molecular Formula | C7H2F10O4 |
| Molecular Weight | 340.07 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoroheptanedioic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C7H2F10O4/c8-3(9,1(18)19)5(12,13)7(16,17)6(14,15)4(10,11)2(20)21/h(H,18,19)(H,20,21) |
| InChIKey | FDYFJLNRDMUFBF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.07 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|