C9H4F14O2 — CID 131700988
2,2,3,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-7-methyloctanoic acid (PubChem CID 131700988) has the molecular formula C9H4F14O2 and a molecular weight of 410.10 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-7-methyloctanoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-7-methyloctanoic acid |
|---|---|
| PubChem CID | 131700988 |
| Molecular Formula | C9H4F14O2 |
| Molecular Weight | 410.10 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-7-methyloctanoic acid |
| SMILES | CC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C9H4F14O2/c1-3(10,9(21,22)23)5(13,14)7(17,18)8(19,20)6(15,16)4(11,12)2(24)25/h1H3,(H,24,25) |
| InChIKey | CYIUUFDKNMJANU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.10 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|