2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride

C7ClF13O — CID 2782569

IUPAC2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride
SMILESO=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C7ClF13O/c8-1(22)2(9,10)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)21
InChIKeyIAHVCTQMGIVZJU-UHFFFAOYSA-N
MW382.50 g/mol
LogP4.49
Rot. Bonds5

About 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride

2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride (PubChem CID 2782569) has the molecular formula C7ClF13O and a molecular weight of 382.50 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride.

Molecular Properties

Compound Name2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride
PubChem CID2782569
Molecular FormulaC7ClF13O
Molecular Weight382.50 g/mol
Exact Mass381.94
IUPAC Name2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride
SMILESO=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C7ClF13O/c8-1(22)2(9,10)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)21
InChIKeyIAHVCTQMGIVZJU-UHFFFAOYSA-N
XLogP4.49
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500382.50
LogP ≤ 54.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride?
The IUPAC name of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride (CID 2782569) is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride.
What is the SMILES notation for 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride?
The canonical SMILES for 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride is O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride?
The InChIKey is IAHVCTQMGIVZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7ClF13O/c8-1(22)2(9,10)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)21.
What are the key properties of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride?
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride has a molecular weight of 382.50 g/mol, XLogP of 4.49, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride is sourced from PubChem (CID 2782569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).