C7ClF13O — CID 2782569
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride (PubChem CID 2782569) has the molecular formula C7ClF13O and a molecular weight of 382.50 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride |
|---|---|
| PubChem CID | 2782569 |
| Molecular Formula | C7ClF13O |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7ClF13O/c8-1(22)2(9,10)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)21 |
| InChIKey | IAHVCTQMGIVZJU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|