C9H9F7O3 — CID 159920783
1-ethenoxy-1,1,2,2,3,3,3-heptafluoropropane;2-methylprop-2-enoic acid (PubChem CID 159920783) has the molecular formula C9H9F7O3 and a molecular weight of 298.15 g/mol. Its IUPAC name is 1-ethenoxy-1,1,2,2,3,3,3-heptafluoropropane;2-methylprop-2-enoic acid.
| Compound Name | 1-ethenoxy-1,1,2,2,3,3,3-heptafluoropropane;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 159920783 |
| Molecular Formula | C9H9F7O3 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-ethenoxy-1,1,2,2,3,3,3-heptafluoropropane;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=COC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F7O.C4H6O2/c1-2-13-5(11,12)3(6,7)4(8,9)10;1-3(2)4(5)6/h2H,1H2;1H2,2H3,(H,5,6) |
| InChIKey | NYJDTUSARZUALD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|