C11H11F7O4 — CID 161115014
1,1,1,2,3,3,3-heptafluoropropan-2-yl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 161115014) has the molecular formula C11H11F7O4 and a molecular weight of 340.19 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptafluoropropan-2-yl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | 1,1,1,2,3,3,3-heptafluoropropan-2-yl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 161115014 |
| Molecular Formula | C11H11F7O4 |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 1,1,1,2,3,3,3-heptafluoropropan-2-yl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H5F7O2.C4H6O2/c1-3(2)4(15)16-5(8,6(9,10)11)7(12,13)14;1-3(2)4(5)6/h1H2,2H3;1H2,2H3,(H,5,6) |
| InChIKey | UKEWCOHYZHMJSK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|