C14H15F7O6 — CID 59746087
5-O-(1,1,1,2,3,3,3-heptafluoropropan-2-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] pentanedioate (PubChem CID 59746087) has the molecular formula C14H15F7O6 and a molecular weight of 412.25 g/mol. Its IUPAC name is 5-O-(1,1,1,2,3,3,3-heptafluoropropan-2-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] pentanedioate.
| Compound Name | 5-O-(1,1,1,2,3,3,3-heptafluoropropan-2-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] pentanedioate |
|---|---|
| PubChem CID | 59746087 |
| Molecular Formula | C14H15F7O6 |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 5-O-(1,1,1,2,3,3,3-heptafluoropropan-2-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] pentanedioate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCCC(=O)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H15F7O6/c1-8(2)11(24)26-7-6-25-9(22)4-3-5-10(23)27-12(15,13(16,17)18)14(19,20)21/h1,3-7H2,2H3 |
| InChIKey | CBRMOSKDEYCZOS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|