C11H15NaO6 — CID 162317079
sodium 5-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxopentanoate (PubChem CID 162317079) has the molecular formula C11H15NaO6 and a molecular weight of 266.22 g/mol. Its IUPAC name is sodium 5-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxopentanoate.
| Compound Name | sodium 5-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxopentanoate |
|---|---|
| PubChem CID | 162317079 |
| Molecular Formula | C11H15NaO6 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | sodium 5-[2-(2-methylprop-2-enoyloxy)ethoxy]-5-oxopentanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H16O6.Na/c1-8(2)11(15)17-7-6-16-10(14)5-3-4-9(12)13;/h1,3-7H2,2H3,(H,12,13);/q;+1/p-1 |
| InChIKey | UESZXMDGRZFXQC-UHFFFAOYSA-M |
| XLogP | -3.43 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|