About 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate
2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate (PubChem CID 129107798) has the molecular formula C11H15NO5
and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate.
Molecular Properties
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate |
| PubChem CID | 129107798 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCCOC#N |
| InChI | InChI=1S/C11H15NO5/c1-9(2)11(14)17-7-6-16-10(13)4-3-5-15-8-12/h1,3-7H2,2H3 |
| InChIKey | ZSXCNYOIQZRCHM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate?
The IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate (CID 129107798) is 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate.
What is the SMILES notation for 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate?
The canonical SMILES for 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate is C=C(C)C(=O)OCCOC(=O)CCCOC#N.
What is the InChIKey of 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate?
The InChIKey is ZSXCNYOIQZRCHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO5/c1-9(2)11(14)17-7-6-16-10(13)4-3-5-15-8-12/h1,3-7H2,2H3.
What are the key properties of 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate?
2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate has a molecular weight of 241.24 g/mol, XLogP of 0.93, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylprop-2-enoyloxy)ethyl 4-cyanatobutanoate is sourced from PubChem (CID 129107798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).