C14H12F12O6 — CID 159792951
(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl) 2-methylprop-2-enoate;5,5,5-trifluoro-4-hydroxy-2-methyl-4-(trifluoromethyl)pent-2-enoic acid (PubChem CID 159792951) has the molecular formula C14H12F12O6 and a molecular weight of 504.22 g/mol. Its IUPAC name is (1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl) 2-methylprop-2-enoate;5,5,5-trifluoro-4-hydroxy-2-methyl-4-(trifluoromethyl)pent-2-enoic acid.
| Compound Name | (1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl) 2-methylprop-2-enoate;5,5,5-trifluoro-4-hydroxy-2-methyl-4-(trifluoromethyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 159792951 |
| Molecular Formula | C14H12F12O6 |
| Molecular Weight | 504.22 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | (1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl) 2-methylprop-2-enoate;5,5,5-trifluoro-4-hydroxy-2-methyl-4-(trifluoromethyl)pent-2-enoic acid |
| SMILES | C=C(C)C(=O)OC(O)(C(F)(F)F)C(F)(F)F.CC(=CC(O)(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/2C7H6F6O3/c1-3(2)4(14)16-5(15,6(8,9)10)7(11,12)13;1-3(4(14)15)2-5(16,6(8,9)10)7(11,12)13/h15H,1H2,2H3;2,16H,1H3,(H,14,15) |
| InChIKey | NIUMVFPUSOCXKN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|