C22H30O10 — CID 174791257
4-hydroxy-4-(1-hydroxyprop-1-enyl)-2,6-dimethylhepta-2,5-dienedioic acid;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate (PubChem CID 174791257) has the molecular formula C22H30O10 and a molecular weight of 454.47 g/mol. Its IUPAC name is 4-hydroxy-4-(1-hydroxyprop-1-enyl)-2,6-dimethylhepta-2,5-dienedioic acid;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 4-hydroxy-4-(1-hydroxyprop-1-enyl)-2,6-dimethylhepta-2,5-dienedioic acid;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174791257 |
| Molecular Formula | C22H30O10 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-hydroxy-4-(1-hydroxyprop-1-enyl)-2,6-dimethylhepta-2,5-dienedioic acid;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=C)C.CC=C(O)C(O)(C=C(C)C(=O)O)C=C(C)C(=O)O |
| InChI | InChI=1S/C12H16O6.C10H14O4/c1-4-9(13)12(18,5-7(2)10(14)15)6-8(3)11(16)17;1-7(2)9(11)13-5-6-14-10(12)8(3)4/h4-6,13,18H,1-3H3,(H,14,15)(H,16,17);1,3,5-6H2,2,4H3 |
| InChIKey | QOGQCOSPTHXESB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|