C12H18O4 — CID 173460089
2-methylbut-2-enoic acid;prop-2-enyl 2-methylprop-2-enoate (PubChem CID 173460089) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-methylbut-2-enoic acid;prop-2-enyl 2-methylprop-2-enoate.
| Compound Name | 2-methylbut-2-enoic acid;prop-2-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173460089 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-methylbut-2-enoic acid;prop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=CCOC(=O)C(=C)C.CC=C(C)C(=O)O |
| InChI | InChI=1S/C7H10O2.C5H8O2/c1-4-5-9-7(8)6(2)3;1-3-4(2)5(6)7/h4H,1-2,5H2,3H3;3H,1-2H3,(H,6,7) |
| InChIKey | YXCTUWQZBCTRHZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|