C12H14F6O4 — CID 20615533
tert-butyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate (PubChem CID 20615533) has the molecular formula C12H14F6O4 and a molecular weight of 336.23 g/mol. Its IUPAC name is tert-butyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate.
| Compound Name | tert-butyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 20615533 |
| Molecular Formula | C12H14F6O4 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | tert-butyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate |
| SMILES | C=C(C)C(=O)OC(C(=O)OC(C)(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O4/c1-6(2)7(19)21-10(11(13,14)15,12(16,17)18)8(20)22-9(3,4)5/h1H2,2-5H3 |
| InChIKey | VRBWXVSOJKZGBK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|