C24H39NO6 — CID 87627513
[1-[bis[2-methyl-2-(2-methylprop-2-enoyloxy)propyl]amino]-2-methylpropan-2-yl] 2-methylprop-2-enoate (PubChem CID 87627513) has the molecular formula C24H39NO6 and a molecular weight of 437.58 g/mol. Its IUPAC name is [1-[bis[2-methyl-2-(2-methylprop-2-enoyloxy)propyl]amino]-2-methylpropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[bis[2-methyl-2-(2-methylprop-2-enoyloxy)propyl]amino]-2-methylpropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87627513 |
| Molecular Formula | C24H39NO6 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | [1-[bis[2-methyl-2-(2-methylprop-2-enoyloxy)propyl]amino]-2-methylpropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CN(CC(C)(C)OC(=O)C(=C)C)CC(C)(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C24H39NO6/c1-16(2)19(26)29-22(7,8)13-25(14-23(9,10)30-20(27)17(3)4)15-24(11,12)31-21(28)18(5)6/h1,3,5,13-15H2,2,4,6-12H3 |
| InChIKey | SVAZIHNCYXHBIW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|