C15H28O3 — CID 123706360
[2-methyl-4-(3-methylpentan-3-yloxy)butan-2-yl] 2-methylprop-2-enoate (PubChem CID 123706360) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is [2-methyl-4-(3-methylpentan-3-yloxy)butan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2-methyl-4-(3-methylpentan-3-yloxy)butan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123706360 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | [2-methyl-4-(3-methylpentan-3-yloxy)butan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CCOC(C)(CC)CC |
| InChI | InChI=1S/C15H28O3/c1-8-15(7,9-2)17-11-10-14(5,6)18-13(16)12(3)4/h3,8-11H2,1-2,4-7H3 |
| InChIKey | FXPUUJWOCYMOTD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|