C17H32O4 — CID 89265326
[1-(3-ethyl-1-hydroxypentan-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate (PubChem CID 89265326) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is [1-(3-ethyl-1-hydroxypentan-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [1-(3-ethyl-1-hydroxypentan-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89265326 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | [1-(3-ethyl-1-hydroxypentan-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(CC)CCOC(CC)(CC)CCO |
| InChI | InChI=1S/C17H32O4/c1-7-16(6,21-15(19)14(4)5)11-13-20-17(8-2,9-3)10-12-18/h18H,4,7-13H2,1-3,5-6H3 |
| InChIKey | DCWOXILXEDHTDY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|