C16H26O6 — CID 140807532
[4-ethyl-1,4-dihydroxy-3-(2-methylprop-2-enoyloxy)hexan-3-yl] 2-methylprop-2-enoate (PubChem CID 140807532) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is [4-ethyl-1,4-dihydroxy-3-(2-methylprop-2-enoyloxy)hexan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [4-ethyl-1,4-dihydroxy-3-(2-methylprop-2-enoyloxy)hexan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140807532 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [4-ethyl-1,4-dihydroxy-3-(2-methylprop-2-enoyloxy)hexan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCO)(OC(=O)C(=C)C)C(O)(CC)CC |
| InChI | InChI=1S/C16H26O6/c1-7-15(20,8-2)16(9-10-17,21-13(18)11(3)4)22-14(19)12(5)6/h17,20H,3,5,7-10H2,1-2,4,6H3 |
| InChIKey | WAFYPPWNKVNVIV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|