C22H29ClO8 — CID 140510055
[1-chloro-1,1,2-tris(2-methylprop-2-enoyloxy)hexan-2-yl] 2-methylprop-2-enoate (PubChem CID 140510055) has the molecular formula C22H29ClO8 and a molecular weight of 456.92 g/mol. Its IUPAC name is [1-chloro-1,1,2-tris(2-methylprop-2-enoyloxy)hexan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-chloro-1,1,2-tris(2-methylprop-2-enoyloxy)hexan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140510055 |
| Molecular Formula | C22H29ClO8 |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | [1-chloro-1,1,2-tris(2-methylprop-2-enoyloxy)hexan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(Cl)(OC(=O)C(=C)C)C(CCCC)(OC(=O)C(=C)C)OC(=O)C(=C)C |
| InChI | InChI=1S/C22H29ClO8/c1-10-11-12-21(28-17(24)13(2)3,29-18(25)14(4)5)22(23,30-19(26)15(6)7)31-20(27)16(8)9/h2,4,6,8,10-12H2,1,3,5,7,9H3 |
| InChIKey | DROIHJKALLROOL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|