C17H28O6 — CID 142740375
[3-ethyl-1,3-dihydroxy-1-(2-methylprop-2-enoyloxy)heptyl] 2-methylprop-2-enoate (PubChem CID 142740375) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [3-ethyl-1,3-dihydroxy-1-(2-methylprop-2-enoyloxy)heptyl] 2-methylprop-2-enoate.
| Compound Name | [3-ethyl-1,3-dihydroxy-1-(2-methylprop-2-enoyloxy)heptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142740375 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [3-ethyl-1,3-dihydroxy-1-(2-methylprop-2-enoyloxy)heptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(O)(CC(O)(CC)CCCC)OC(=O)C(=C)C |
| InChI | InChI=1S/C17H28O6/c1-7-9-10-16(20,8-2)11-17(21,22-14(18)12(3)4)23-15(19)13(5)6/h20-21H,3,5,7-11H2,1-2,4,6H3 |
| InChIKey | YNLKLJMEGCLVOD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|