C16H28NO5+ — CID 123399868
dimethyl-[3-methyl-3-(2-methylprop-2-enoyloxy)butoxy]-(2-methylprop-2-enoyloxymethyl)azanium (PubChem CID 123399868) has the molecular formula C16H28NO5+ and a molecular weight of 314.40 g/mol. Its IUPAC name is dimethyl-[3-methyl-3-(2-methylprop-2-enoyloxy)butoxy]-(2-methylprop-2-enoyloxymethyl)azanium.
| Compound Name | dimethyl-[3-methyl-3-(2-methylprop-2-enoyloxy)butoxy]-(2-methylprop-2-enoyloxymethyl)azanium |
|---|---|
| PubChem CID | 123399868 |
| Molecular Formula | C16H28NO5+ |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | dimethyl-[3-methyl-3-(2-methylprop-2-enoyloxy)butoxy]-(2-methylprop-2-enoyloxymethyl)azanium |
| SMILES | C=C(C)C(=O)OC[N+](C)(C)OCCC(C)(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C16H28NO5/c1-12(2)14(18)20-11-17(7,8)21-10-9-16(5,6)22-15(19)13(3)4/h1,3,9-11H2,2,4-8H3/q+1 |
| InChIKey | YJAQNYXNPRVXKX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|