About deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium
deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium (PubChem CID 158402875) has the molecular formula C8H18NO2+
and a molecular weight of 161.24 g/mol. Its IUPAC name is deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium.
Molecular Properties
| Compound Name | deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium |
| PubChem CID | 158402875 |
| Molecular Formula | C8H18NO2+ |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium |
| SMILES | C=C(C)C(=O)OC[N+](C)(C)C.[H][2H] |
| InChI | InChI=1S/C8H16NO2.H2/c1-7(2)8(10)11-6-9(3,4)5;/h1,6H2,2-5H3;1H/q+1;/i;1+1 |
| InChIKey | GYHWZOMRMKDMPI-IEOVAKBOSA-N |
| XLogP | 1.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium?
The IUPAC name of deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium (CID 158402875) is deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium.
What is the SMILES notation for deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium?
The canonical SMILES for deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium is C=C(C)C(=O)OC[N+](C)(C)C.[H][2H].
What is the InChIKey of deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium?
The InChIKey is GYHWZOMRMKDMPI-IEOVAKBOSA-N. The full InChI is InChI=1S/C8H16NO2.H2/c1-7(2)8(10)11-6-9(3,4)5;/h1,6H2,2-5H3;1H/q+1;/i;1+1.
What are the key properties of deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium?
deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium has a molecular weight of 161.24 g/mol, XLogP of 1.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for deuterium monohydride;trimethyl(2-methylprop-2-enoyloxymethyl)azanium is sourced from PubChem (CID 158402875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).