C12H23ClN2O3 — CID 162083894
ethyl-dimethyl-(2-methylprop-2-enoyloxymethyl)azanium;prop-2-enamide;chloride (PubChem CID 162083894) has the molecular formula C12H23ClN2O3 and a molecular weight of 278.78 g/mol. Its IUPAC name is ethyl-dimethyl-(2-methylprop-2-enoyloxymethyl)azanium;prop-2-enamide;chloride.
| Compound Name | ethyl-dimethyl-(2-methylprop-2-enoyloxymethyl)azanium;prop-2-enamide;chloride |
|---|---|
| PubChem CID | 162083894 |
| Molecular Formula | C12H23ClN2O3 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | ethyl-dimethyl-(2-methylprop-2-enoyloxymethyl)azanium;prop-2-enamide;chloride |
| SMILES | C=C(C)C(=O)OC[N+](C)(C)CC.C=CC(N)=O.[Cl-] |
| InChI | InChI=1S/C9H18NO2.C3H5NO.ClH/c1-6-10(4,5)7-12-9(11)8(2)3;1-2-3(4)5;/h2,6-7H2,1,3-5H3;2H,1H2,(H2,4,5);1H/q+1;;/p-1 |
| InChIKey | ZCRXDRKMRBWQHB-UHFFFAOYSA-M |
| XLogP | -2.18 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|