About ethyl-dimethyl-octylazanium;prop-2-enamide;chloride
ethyl-dimethyl-octylazanium;prop-2-enamide;chloride (PubChem CID 160519683) has the molecular formula C15H33ClN2O
and a molecular weight of 292.89 g/mol. Its IUPAC name is ethyl-dimethyl-octylazanium;prop-2-enamide;chloride.
Molecular Properties
| Compound Name | ethyl-dimethyl-octylazanium;prop-2-enamide;chloride |
| PubChem CID | 160519683 |
| Molecular Formula | C15H33ClN2O |
| Molecular Weight | 292.89 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | ethyl-dimethyl-octylazanium;prop-2-enamide;chloride |
| SMILES | C=CC(N)=O.CCCCCCCC[N+](C)(C)CC.[Cl-] |
| InChI | InChI=1S/C12H28N.C3H5NO.ClH/c1-5-7-8-9-10-11-12-13(3,4)6-2;1-2-3(4)5;/h5-12H2,1-4H3;2H,1H2,(H2,4,5);1H/q+1;;/p-1 |
| InChIKey | NMVMXYQDUYYBSB-UHFFFAOYSA-M |
| XLogP | 0.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.89 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl-dimethyl-octylazanium;prop-2-enamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-dimethyl-octylazanium;prop-2-enamide;chloride?
The IUPAC name of ethyl-dimethyl-octylazanium;prop-2-enamide;chloride (CID 160519683) is ethyl-dimethyl-octylazanium;prop-2-enamide;chloride.
What is the SMILES notation for ethyl-dimethyl-octylazanium;prop-2-enamide;chloride?
The canonical SMILES for ethyl-dimethyl-octylazanium;prop-2-enamide;chloride is C=CC(N)=O.CCCCCCCC[N+](C)(C)CC.[Cl-].
What is the InChIKey of ethyl-dimethyl-octylazanium;prop-2-enamide;chloride?
The InChIKey is NMVMXYQDUYYBSB-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.C3H5NO.ClH/c1-5-7-8-9-10-11-12-13(3,4)6-2;1-2-3(4)5;/h5-12H2,1-4H3;2H,1H2,(H2,4,5);1H/q+1;;/p-1.
What are the key properties of ethyl-dimethyl-octylazanium;prop-2-enamide;chloride?
ethyl-dimethyl-octylazanium;prop-2-enamide;chloride has a molecular weight of 292.89 g/mol, XLogP of 0.10, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-dimethyl-octylazanium;prop-2-enamide;chloride is sourced from PubChem (CID 160519683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).