C17H34NO2+ — CID 45270101
decyl-dimethyl-(2-prop-2-enoyloxyethyl)azanium (PubChem CID 45270101) has the molecular formula C17H34NO2+ and a molecular weight of 284.46 g/mol. Its IUPAC name is decyl-dimethyl-(2-prop-2-enoyloxyethyl)azanium.
| Compound Name | decyl-dimethyl-(2-prop-2-enoyloxyethyl)azanium |
|---|---|
| PubChem CID | 45270101 |
| Molecular Formula | C17H34NO2+ |
| Molecular Weight | 284.46 g/mol |
| Exact Mass | 284.26 |
| IUPAC Name | decyl-dimethyl-(2-prop-2-enoyloxyethyl)azanium |
| SMILES | C=CC(=O)OCC[N+](C)(C)CCCCCCCCCC |
| InChI | InChI=1S/C17H34NO2/c1-5-7-8-9-10-11-12-13-14-18(3,4)15-16-20-17(19)6-2/h6H,2,5,7-16H2,1,3-4H3/q+1 |
| InChIKey | SKVQYXQLQDKCJO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|