C24H48INO2 — CID 164853911
methyl-di(nonyl)-(2-prop-2-enoyloxyethyl)azanium iodide (PubChem CID 164853911) has the molecular formula C24H48INO2 and a molecular weight of 509.56 g/mol. Its IUPAC name is methyl-di(nonyl)-(2-prop-2-enoyloxyethyl)azanium iodide.
| Compound Name | methyl-di(nonyl)-(2-prop-2-enoyloxyethyl)azanium iodide |
|---|---|
| PubChem CID | 164853911 |
| Molecular Formula | C24H48INO2 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | methyl-di(nonyl)-(2-prop-2-enoyloxyethyl)azanium iodide |
| SMILES | C=CC(=O)OCC[N+](C)(CCCCCCCCC)CCCCCCCCC.[I-] |
| InChI | InChI=1S/C24H48NO2.HI/c1-5-8-10-12-14-16-18-20-25(4,22-23-27-24(26)7-3)21-19-17-15-13-11-9-6-2;/h7H,3,5-6,8-23H2,1-2,4H3;1H/q+1;/p-1 |
| InChIKey | AAWISFJPNMUYMS-UHFFFAOYSA-M |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|