C29H48NO4+ — CID 132515683
methyl-[(9Z,11E,13E)-octadeca-9,11,13-trienyl]-bis(2-prop-2-enoyloxyethyl)azanium (PubChem CID 132515683) has the molecular formula C29H48NO4+ and a molecular weight of 474.71 g/mol. Its IUPAC name is methyl-[(9Z,11E,13E)-octadeca-9,11,13-trienyl]-bis(2-prop-2-enoyloxyethyl)azanium.
| Compound Name | methyl-[(9Z,11E,13E)-octadeca-9,11,13-trienyl]-bis(2-prop-2-enoyloxyethyl)azanium |
|---|---|
| PubChem CID | 132515683 |
| Molecular Formula | C29H48NO4+ |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.36 |
| IUPAC Name | methyl-[(9Z,11E,13E)-octadeca-9,11,13-trienyl]-bis(2-prop-2-enoyloxyethyl)azanium |
| SMILES | C=CC(=O)OCC[N+](C)(CCCCCCCC/C=C\C=C\C=C\CCCC)CCOC(=O)C=C |
| InChI | InChI=1S/C29H48NO4/c1-5-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-30(4,24-26-33-28(31)6-2)25-27-34-29(32)7-3/h6-7,10-15H,2-3,5,8-9,16-27H2,1,4H3/q+1/b11-10+,13-12+,15-14- |
| InChIKey | LWHNCJKXJYRDKI-VEIXPLCLSA-N |
| XLogP | 6.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|