About diethyl(dimethyl)azanium;prop-2-enamide
diethyl(dimethyl)azanium;prop-2-enamide (PubChem CID 19752026) has the molecular formula C9H21N2O+
and a molecular weight of 173.28 g/mol. Its IUPAC name is diethyl(dimethyl)azanium;prop-2-enamide.
Molecular Properties
| Compound Name | diethyl(dimethyl)azanium;prop-2-enamide |
| PubChem CID | 19752026 |
| Molecular Formula | C9H21N2O+ |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | diethyl(dimethyl)azanium;prop-2-enamide |
| SMILES | C=CC(N)=O.CC[N+](C)(C)CC |
| InChI | InChI=1S/C6H16N.C3H5NO/c1-5-7(3,4)6-2;1-2-3(4)5/h5-6H2,1-4H3;2H,1H2,(H2,4,5)/q+1; |
| InChIKey | POQPOUXTSKWDDX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl(dimethyl)azanium;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(dimethyl)azanium;prop-2-enamide?
The IUPAC name of diethyl(dimethyl)azanium;prop-2-enamide (CID 19752026) is diethyl(dimethyl)azanium;prop-2-enamide.
What is the SMILES notation for diethyl(dimethyl)azanium;prop-2-enamide?
The canonical SMILES for diethyl(dimethyl)azanium;prop-2-enamide is C=CC(N)=O.CC[N+](C)(C)CC.
What is the InChIKey of diethyl(dimethyl)azanium;prop-2-enamide?
The InChIKey is POQPOUXTSKWDDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N.C3H5NO/c1-5-7(3,4)6-2;1-2-3(4)5/h5-6H2,1-4H3;2H,1H2,(H2,4,5)/q+1;.
What are the key properties of diethyl(dimethyl)azanium;prop-2-enamide?
diethyl(dimethyl)azanium;prop-2-enamide has a molecular weight of 173.28 g/mol, XLogP of 0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(dimethyl)azanium;prop-2-enamide is sourced from PubChem (CID 19752026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).