C9H19ClN2O — CID 174934724
prop-2-enamide;trimethyl(prop-2-enyl)azanium;chloride (PubChem CID 174934724) has the molecular formula C9H19ClN2O and a molecular weight of 206.72 g/mol. Its IUPAC name is prop-2-enamide;trimethyl(prop-2-enyl)azanium;chloride.
| Compound Name | prop-2-enamide;trimethyl(prop-2-enyl)azanium;chloride |
|---|---|
| PubChem CID | 174934724 |
| Molecular Formula | C9H19ClN2O |
| Molecular Weight | 206.72 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | prop-2-enamide;trimethyl(prop-2-enyl)azanium;chloride |
| SMILES | C=CC(N)=O.C=CC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C6H14N.C3H5NO.ClH/c1-5-6-7(2,3)4;1-2-3(4)5;/h5H,1,6H2,2-4H3;2H,1H2,(H2,4,5);1H/q+1;;/p-1 |
| InChIKey | DXSMRZZDLLMCRS-UHFFFAOYSA-M |
| XLogP | -2.46 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.72 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|