C6H16ClNO4S — CID 175609144
sulfuric acid;trimethyl(prop-2-enyl)azanium;chloride (PubChem CID 175609144) has the molecular formula C6H16ClNO4S and a molecular weight of 233.72 g/mol. Its IUPAC name is sulfuric acid;trimethyl(prop-2-enyl)azanium;chloride.
| Compound Name | sulfuric acid;trimethyl(prop-2-enyl)azanium;chloride |
|---|---|
| PubChem CID | 175609144 |
| Molecular Formula | C6H16ClNO4S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | sulfuric acid;trimethyl(prop-2-enyl)azanium;chloride |
| SMILES | C=CC[N+](C)(C)C.O=S(=O)(O)O.[Cl-] |
| InChI | InChI=1S/C6H14N.ClH.H2O4S/c1-5-6-7(2,3)4;;1-5(2,3)4/h5H,1,6H2,2-4H3;1H;(H2,1,2,3,4)/q+1;;/p-1 |
| InChIKey | TVLHJUNNRLNDFK-UHFFFAOYSA-M |
| XLogP | -2.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|