About dimethyl-bis(prop-2-enyl)azanium;polane;chloride
dimethyl-bis(prop-2-enyl)azanium;polane;chloride (PubChem CID 173045035) has the molecular formula C8H18ClNPo
and a molecular weight of 372.69 g/mol. Its IUPAC name is dimethyl-bis(prop-2-enyl)azanium;polane;chloride.
Molecular Properties
| Compound Name | dimethyl-bis(prop-2-enyl)azanium;polane;chloride |
| PubChem CID | 173045035 |
| Molecular Formula | C8H18ClNPo |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | dimethyl-bis(prop-2-enyl)azanium;polane;chloride |
| SMILES | C=CC[N+](C)(C)CC=C.[Cl-].[PoH2] |
| InChI | InChI=1S/C8H16N.ClH.Po.2H/c1-5-7-9(3,4)8-6-2;;;;/h5-6H,1-2,7-8H2,3-4H3;1H;;;/q+1;;;;/p-1 |
| InChIKey | ATDQLYXWFCSJLH-UHFFFAOYSA-M |
| XLogP | -2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis(prop-2-enyl)azanium;polane;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis(prop-2-enyl)azanium;polane;chloride?
The IUPAC name of dimethyl-bis(prop-2-enyl)azanium;polane;chloride (CID 173045035) is dimethyl-bis(prop-2-enyl)azanium;polane;chloride.
What is the SMILES notation for dimethyl-bis(prop-2-enyl)azanium;polane;chloride?
The canonical SMILES for dimethyl-bis(prop-2-enyl)azanium;polane;chloride is C=CC[N+](C)(C)CC=C.[Cl-].[PoH2].
What is the InChIKey of dimethyl-bis(prop-2-enyl)azanium;polane;chloride?
The InChIKey is ATDQLYXWFCSJLH-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16N.ClH.Po.2H/c1-5-7-9(3,4)8-6-2;;;;/h5-6H,1-2,7-8H2,3-4H3;1H;;;/q+1;;;;/p-1.
What are the key properties of dimethyl-bis(prop-2-enyl)azanium;polane;chloride?
dimethyl-bis(prop-2-enyl)azanium;polane;chloride has a molecular weight of 372.69 g/mol, XLogP of -2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis(prop-2-enyl)azanium;polane;chloride is sourced from PubChem (CID 173045035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).