C13H26NO2+ — CID 87375261
dimethyl-bis(prop-2-enyl)azanium;2,2-dimethylpropanoic acid (PubChem CID 87375261) has the molecular formula C13H26NO2+ and a molecular weight of 228.36 g/mol. Its IUPAC name is dimethyl-bis(prop-2-enyl)azanium;2,2-dimethylpropanoic acid.
| Compound Name | dimethyl-bis(prop-2-enyl)azanium;2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 87375261 |
| Molecular Formula | C13H26NO2+ |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | dimethyl-bis(prop-2-enyl)azanium;2,2-dimethylpropanoic acid |
| SMILES | C=CC[N+](C)(C)CC=C.CC(C)(C)C(=O)O |
| InChI | InChI=1S/C8H16N.C5H10O2/c1-5-7-9(3,4)8-6-2;1-5(2,3)4(6)7/h5-6H,1-2,7-8H2,3-4H3;1-3H3,(H,6,7)/q+1; |
| InChIKey | CSNKDUSRXQPGNI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|